C34H52O7Si — CID 25023359
tert-butyl-[[(1S,2R,3S,4S,6R)-3-(2,2-dimethoxyethyl)-2-[(4-methoxyphenyl)methoxymethyl]-3-methyl-1-phenylmethoxy-7-oxabicyclo[4.2.0]octan-4-yl]oxy]-dimethylsilane (PubChem CID 25023359) has the molecular formula C34H52O7Si and a molecular weight of 600.87 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,3S,4S,6R)-3-(2,2-dimethoxyethyl)-2-[(4-methoxyphenyl)methoxymethyl]-3-methyl-1-phenylmethoxy-7-oxabicyclo[4.2.0]octan-4-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2R,3S,4S,6R)-3-(2,2-dimethoxyethyl)-2-[(4-methoxyphenyl)methoxymethyl]-3-methyl-1-phenylmethoxy-7-oxabicyclo[4.2.0]octan-4-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 25023359 |
| Molecular Formula | C34H52O7Si |
| Molecular Weight | 600.87 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | tert-butyl-[[(1S,2R,3S,4S,6R)-3-(2,2-dimethoxyethyl)-2-[(4-methoxyphenyl)methoxymethyl]-3-methyl-1-phenylmethoxy-7-oxabicyclo[4.2.0]octan-4-yl]oxy]-dimethylsilane |
| SMILES | COc1ccc(COC[C@H]2[C@](C)(CC(OC)OC)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]3OC[C@]32OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H52O7Si/c1-32(2,3)42(8,9)41-29-19-30-34(24-39-30,40-22-25-13-11-10-12-14-25)28(33(29,4)20-31(36-6)37-7)23-38-21-26-15-17-27(35-5)18-16-26/h10-18,28-31H,19-24H2,1-9H3/t28-,29-,30+,33-,34+/m0/s1 |
| InChIKey | IQIJTXGTKUMQKU-VTHVVLAZSA-N |
| XLogP | 6.99 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.87 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|