C34H41BF4N2O4 — CID 25029329
[7-tert-butyl-4-[(1E,3E)-4-[7-(diethylamino)-2,4-dioxochromen-3-yl]buta-1,3-dienyl]chromen-2-ylidene]-diethylazanium tetrafluoroborate (PubChem CID 25029329) has the molecular formula C34H41BF4N2O4 and a molecular weight of 628.52 g/mol. Its IUPAC name is [7-tert-butyl-4-[(1E,3E)-4-[7-(diethylamino)-2,4-dioxochromen-3-yl]buta-1,3-dienyl]chromen-2-ylidene]-diethylazanium tetrafluoroborate.
| Compound Name | [7-tert-butyl-4-[(1E,3E)-4-[7-(diethylamino)-2,4-dioxochromen-3-yl]buta-1,3-dienyl]chromen-2-ylidene]-diethylazanium tetrafluoroborate |
|---|---|
| PubChem CID | 25029329 |
| Molecular Formula | C34H41BF4N2O4 |
| Molecular Weight | 628.52 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | [7-tert-butyl-4-[(1E,3E)-4-[7-(diethylamino)-2,4-dioxochromen-3-yl]buta-1,3-dienyl]chromen-2-ylidene]-diethylazanium tetrafluoroborate |
| SMILES | CCN(CC)c1ccc2c(c1)OC(=O)C(/C=C/C=C/c1cc(=[N+](CC)CC)oc3cc(C(C)(C)C)ccc13)C2=O.F[B-](F)(F)F |
| InChI | InChI=1S/C34H41N2O4.BF4/c1-8-35(9-2)25-17-19-27-30(22-25)40-33(38)28(32(27)37)15-13-12-14-23-20-31(36(10-3)11-4)39-29-21-24(34(5,6)7)16-18-26(23)29;2-1(3,4)5/h12-22,28H,8-11H2,1-7H3;/q+1;-1/b14-12+,15-13+; |
| InChIKey | CSKRKMIKOMWCJK-ZUADHLFUSA-N |
| XLogP | 7.68 |
| TPSA | 62.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.52 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|