C21H24O2 — CID 25047353
(2'Z,9'Z)-5,5-dimethylspiro[cyclohexane-2,6'-tricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraene]-1,3-dione (PubChem CID 25047353) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (2'Z,9'Z)-5,5-dimethylspiro[cyclohexane-2,6'-tricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraene]-1,3-dione.
| Compound Name | (2'Z,9'Z)-5,5-dimethylspiro[cyclohexane-2,6'-tricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraene]-1,3-dione |
|---|---|
| PubChem CID | 25047353 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (2'Z,9'Z)-5,5-dimethylspiro[cyclohexane-2,6'-tricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraene]-1,3-dione |
| SMILES | CC1(C)CC(=O)C2(CC3=C(/C=C\C4=C(/C=C\3)CCC4)C2)C(=O)C1 |
| InChI | InChI=1S/C21H24O2/c1-20(2)12-18(22)21(19(23)13-20)10-16-8-6-14-4-3-5-15(14)7-9-17(16)11-21/h6-9H,3-5,10-13H2,1-2H3/b8-6-,9-7-,14-6-,15-7-,16-8-,17-9- |
| InChIKey | CNHHFYGLFFJHRL-CAUKFGLTSA-N |
| XLogP | 4.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|