C20H16F3N5O2 — CID 25057155
ethyl 2-[1-[6-[6-(trifluoromethyl)indazol-1-yl]pyrazin-2-yl]pyrrol-3-yl]acetate (PubChem CID 25057155) has the molecular formula C20H16F3N5O2 and a molecular weight of 415.38 g/mol. Its IUPAC name is ethyl 2-[1-[6-[6-(trifluoromethyl)indazol-1-yl]pyrazin-2-yl]pyrrol-3-yl]acetate.
| Compound Name | ethyl 2-[1-[6-[6-(trifluoromethyl)indazol-1-yl]pyrazin-2-yl]pyrrol-3-yl]acetate |
|---|---|
| PubChem CID | 25057155 |
| Molecular Formula | C20H16F3N5O2 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | ethyl 2-[1-[6-[6-(trifluoromethyl)indazol-1-yl]pyrazin-2-yl]pyrrol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1ccn(-c2cncc(-n3ncc4ccc(C(F)(F)F)cc43)n2)c1 |
| InChI | InChI=1S/C20H16F3N5O2/c1-2-30-19(29)7-13-5-6-27(12-13)17-10-24-11-18(26-17)28-16-8-15(20(21,22)23)4-3-14(16)9-25-28/h3-6,8-12H,2,7H2,1H3 |
| InChIKey | LHMPZJWAVXHVPF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |