C26H42N4O6S — CID 25098724
(3S,4aS,8aS)-N-tert-butyl-2-[(2R)-2-hydroxy-3-[(4-nitrophenyl)sulfonyl-propylamino]propyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 25098724) has the molecular formula C26H42N4O6S and a molecular weight of 538.71 g/mol. Its IUPAC name is (3S,4aS,8aS)-N-tert-butyl-2-[(2R)-2-hydroxy-3-[(4-nitrophenyl)sulfonyl-propylamino]propyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S,4aS,8aS)-N-tert-butyl-2-[(2R)-2-hydroxy-3-[(4-nitrophenyl)sulfonyl-propylamino]propyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 25098724 |
| Molecular Formula | C26H42N4O6S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | (3S,4aS,8aS)-N-tert-butyl-2-[(2R)-2-hydroxy-3-[(4-nitrophenyl)sulfonyl-propylamino]propyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCCN(C[C@H](O)CN1C[C@H]2CCCC[C@H]2C[C@H]1C(=O)NC(C)(C)C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H42N4O6S/c1-5-14-29(37(35,36)23-12-10-21(11-13-23)30(33)34)18-22(31)17-28-16-20-9-7-6-8-19(20)15-24(28)25(32)27-26(2,3)4/h10-13,19-20,22,24,31H,5-9,14-18H2,1-4H3,(H,27,32)/t19-,20+,22+,24-/m0/s1 |
| InChIKey | OTKUZOZACXUYEV-IKJKNFHUSA-N |
| XLogP | 3.15 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|