C20H38O4Si — CID 25098859
(3S,5Z,7E)-1-[tert-butyl(dimethyl)silyl]oxy-9-(oxan-2-yloxy)nona-5,7-dien-3-ol (PubChem CID 25098859) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (3S,5Z,7E)-1-[tert-butyl(dimethyl)silyl]oxy-9-(oxan-2-yloxy)nona-5,7-dien-3-ol.
| Compound Name | (3S,5Z,7E)-1-[tert-butyl(dimethyl)silyl]oxy-9-(oxan-2-yloxy)nona-5,7-dien-3-ol |
|---|---|
| PubChem CID | 25098859 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (3S,5Z,7E)-1-[tert-butyl(dimethyl)silyl]oxy-9-(oxan-2-yloxy)nona-5,7-dien-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](O)C/C=C\C=C\COC1CCCCO1 |
| InChI | InChI=1S/C20H38O4Si/c1-20(2,3)25(4,5)24-17-14-18(21)12-8-6-7-10-15-22-19-13-9-11-16-23-19/h6-8,10,18-19,21H,9,11-17H2,1-5H3/b8-6-,10-7+/t18-,19?/m0/s1 |
| InChIKey | SXNHLKBFFZLNJT-RWRHSKDNSA-N |
| XLogP | 4.80 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|