C19H36O4Si — CID 42631871
(E,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-7-(oxan-2-yloxy)hept-5-en-2-ol (PubChem CID 42631871) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (E,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-7-(oxan-2-yloxy)hept-5-en-2-ol.
| Compound Name | (E,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-7-(oxan-2-yloxy)hept-5-en-2-ol |
|---|---|
| PubChem CID | 42631871 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (E,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-7-(oxan-2-yloxy)hept-5-en-2-ol |
| SMILES | C=C(/C=C/COC1CCCCO1)C[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-16(10-9-13-22-18-11-7-8-12-21-18)14-17(20)15-23-24(5,6)19(2,3)4/h9-10,17-18,20H,1,7-8,11-15H2,2-6H3/b10-9+/t17-,18?/m1/s1 |
| InChIKey | LGMDXIWCJRMDIF-VOAQMLOASA-N |
| XLogP | 4.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|