C18H33NO4 — CID 25098951
tert-butyl 2-[(Z)-4-methoxyoct-2-enoxy]pyrrolidine-1-carboxylate (PubChem CID 25098951) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl 2-[(Z)-4-methoxyoct-2-enoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(Z)-4-methoxyoct-2-enoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 25098951 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl 2-[(Z)-4-methoxyoct-2-enoxy]pyrrolidine-1-carboxylate |
| SMILES | CCCCC(/C=C\COC1CCCN1C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C18H33NO4/c1-6-7-10-15(21-5)11-9-14-22-16-12-8-13-19(16)17(20)23-18(2,3)4/h9,11,15-16H,6-8,10,12-14H2,1-5H3/b11-9- |
| InChIKey | LVCVZOCGJPANSR-LUAWRHEFSA-N |
| XLogP | 4.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|