C24H44N2O5 — CID 122213395
1-O-tert-butyl 2-O-[(5S)-1-(methylamino)-1-oxotridecan-5-yl] pyrrolidine-1,2-dicarboxylate (PubChem CID 122213395) has the molecular formula C24H44N2O5 and a molecular weight of 440.63 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[(5S)-1-(methylamino)-1-oxotridecan-5-yl] pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[(5S)-1-(methylamino)-1-oxotridecan-5-yl] pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 122213395 |
| Molecular Formula | C24H44N2O5 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 1-O-tert-butyl 2-O-[(5S)-1-(methylamino)-1-oxotridecan-5-yl] pyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCCCCC[C@@H](CCCC(=O)NC)OC(=O)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H44N2O5/c1-6-7-8-9-10-11-14-19(15-12-17-21(27)25-5)30-22(28)20-16-13-18-26(20)23(29)31-24(2,3)4/h19-20H,6-18H2,1-5H3,(H,25,27)/t19-,20?/m0/s1 |
| InChIKey | UQRWCILGEDCSGD-XJDOXCRVSA-N |
| XLogP | 4.96 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|