C25H44N2O6 — CID 70676407
1-O-tert-butyl 2-O-[2-(tert-butylamino)-1-[(2S,3R)-3-heptyloxiran-2-yl]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 70676407) has the molecular formula C25H44N2O6 and a molecular weight of 468.64 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[2-(tert-butylamino)-1-[(2S,3R)-3-heptyloxiran-2-yl]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[2-(tert-butylamino)-1-[(2S,3R)-3-heptyloxiran-2-yl]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70676407 |
| Molecular Formula | C25H44N2O6 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 1-O-tert-butyl 2-O-[2-(tert-butylamino)-1-[(2S,3R)-3-heptyloxiran-2-yl]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCCCC[C@H]1O[C@@H]1C(OC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C25H44N2O6/c1-8-9-10-11-12-15-18-19(31-18)20(21(28)26-24(2,3)4)32-22(29)17-14-13-16-27(17)23(30)33-25(5,6)7/h17-20H,8-16H2,1-7H3,(H,26,28)/t17-,18+,19-,20?/m0/s1 |
| InChIKey | KMRWXBCFRLDGCG-COHPWVSRSA-N |
| XLogP | 4.34 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|