C22H28INO3 — CID 25110728
(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-(6-methoxynaphthalen-2-yl)acetate iodide (PubChem CID 25110728) has the molecular formula C22H28INO3 and a molecular weight of 481.37 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-(6-methoxynaphthalen-2-yl)acetate iodide.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-(6-methoxynaphthalen-2-yl)acetate iodide |
|---|---|
| PubChem CID | 25110728 |
| Molecular Formula | C22H28INO3 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-(6-methoxynaphthalen-2-yl)acetate iodide |
| SMILES | COc1ccc2cc(CC(=O)OC3CC4CCC(C3)[N+]4(C)C)ccc2c1.[I-] |
| InChI | InChI=1S/C22H28NO3.HI/c1-23(2)18-7-8-19(23)14-21(13-18)26-22(24)11-15-4-5-17-12-20(25-3)9-6-16(17)10-15;/h4-6,9-10,12,18-19,21H,7-8,11,13-14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | BHPUWZOZKOURTR-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|