C26H29N5O2 — CID 25121879
1-cyclohexyl-N-(3-imidazol-1-ylpropyl)-3-oxo-2-phenylindazole-5-carboxamide (PubChem CID 25121879) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-cyclohexyl-N-(3-imidazol-1-ylpropyl)-3-oxo-2-phenylindazole-5-carboxamide.
| Compound Name | 1-cyclohexyl-N-(3-imidazol-1-ylpropyl)-3-oxo-2-phenylindazole-5-carboxamide |
|---|---|
| PubChem CID | 25121879 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 1-cyclohexyl-N-(3-imidazol-1-ylpropyl)-3-oxo-2-phenylindazole-5-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc2c(c1)c(=O)n(-c1ccccc1)n2C1CCCCC1 |
| InChI | InChI=1S/C26H29N5O2/c32-25(28-14-7-16-29-17-15-27-19-29)20-12-13-24-23(18-20)26(33)31(22-10-5-2-6-11-22)30(24)21-8-3-1-4-9-21/h2,5-6,10-13,15,17-19,21H,1,3-4,7-9,14,16H2,(H,28,32) |
| InChIKey | FWTDCUVTDILFDR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|