C16H23NO3S — CID 25133511
(1S)-2-tert-butylsulfonyl-1-cyclopropyl-5-methyl-1,3-dihydroisoindol-4-ol (PubChem CID 25133511) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is (1S)-2-tert-butylsulfonyl-1-cyclopropyl-5-methyl-1,3-dihydroisoindol-4-ol.
| Compound Name | (1S)-2-tert-butylsulfonyl-1-cyclopropyl-5-methyl-1,3-dihydroisoindol-4-ol |
|---|---|
| PubChem CID | 25133511 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (1S)-2-tert-butylsulfonyl-1-cyclopropyl-5-methyl-1,3-dihydroisoindol-4-ol |
| SMILES | Cc1ccc2c(c1O)CN(S(=O)(=O)C(C)(C)C)[C@H]2C1CC1 |
| InChI | InChI=1S/C16H23NO3S/c1-10-5-8-12-13(15(10)18)9-17(14(12)11-6-7-11)21(19,20)16(2,3)4/h5,8,11,14,18H,6-7,9H2,1-4H3/t14-/m0/s1 |
| InChIKey | KUZCZHMQHSCWJL-AWEZNQCLSA-N |
| XLogP | 3.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|