C14H17BrN2O2 — CID 25137235
(4aS,8aS)-3-(5-bromo-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one (PubChem CID 25137235) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is (4aS,8aS)-3-(5-bromo-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one.
| Compound Name | (4aS,8aS)-3-(5-bromo-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 25137235 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | (4aS,8aS)-3-(5-bromo-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one |
| SMILES | O=C1N[C@H]2CCCC[C@@H]2NC1c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H17BrN2O2/c15-8-5-6-12(18)9(7-8)13-14(19)17-11-4-2-1-3-10(11)16-13/h5-7,10-11,13,16,18H,1-4H2,(H,17,19)/t10-,11-,13?/m0/s1 |
| InChIKey | DYHVENJTCORTCA-WAQLSPKVSA-N |
| XLogP | 2.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|