C14H16BrNO2 — CID 14984744
2-[(4aR,8aS)-2,4,4a,5,8,8a-hexahydro-1H-3,1-benzoxazin-2-yl]-4-bromophenol (PubChem CID 14984744) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is 2-[(4aR,8aS)-2,4,4a,5,8,8a-hexahydro-1H-3,1-benzoxazin-2-yl]-4-bromophenol.
| Compound Name | 2-[(4aR,8aS)-2,4,4a,5,8,8a-hexahydro-1H-3,1-benzoxazin-2-yl]-4-bromophenol |
|---|---|
| PubChem CID | 14984744 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-[(4aR,8aS)-2,4,4a,5,8,8a-hexahydro-1H-3,1-benzoxazin-2-yl]-4-bromophenol |
| SMILES | Oc1ccc(Br)cc1C1N[C@H]2CC=CC[C@H]2CO1 |
| InChI | InChI=1S/C14H16BrNO2/c15-10-5-6-13(17)11(7-10)14-16-12-4-2-1-3-9(12)8-18-14/h1-2,5-7,9,12,14,16-17H,3-4,8H2/t9-,12-,14?/m0/s1 |
| InChIKey | CLEODVCWUGZCRR-LLBSRUCJSA-N |
| XLogP | 3.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|