C26H20BrNO2 — CID 40844174
4-bromo-2-[(2R)-4,4-diphenyl-1,2-dihydro-3,1-benzoxazin-2-yl]phenol (PubChem CID 40844174) has the molecular formula C26H20BrNO2 and a molecular weight of 458.36 g/mol. Its IUPAC name is 4-bromo-2-[(2R)-4,4-diphenyl-1,2-dihydro-3,1-benzoxazin-2-yl]phenol.
| Compound Name | 4-bromo-2-[(2R)-4,4-diphenyl-1,2-dihydro-3,1-benzoxazin-2-yl]phenol |
|---|---|
| PubChem CID | 40844174 |
| Molecular Formula | C26H20BrNO2 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 4-bromo-2-[(2R)-4,4-diphenyl-1,2-dihydro-3,1-benzoxazin-2-yl]phenol |
| SMILES | Oc1ccc(Br)cc1[C@@H]1Nc2ccccc2C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C26H20BrNO2/c27-20-15-16-24(29)21(17-20)25-28-23-14-8-7-13-22(23)26(30-25,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17,25,28-29H/t25-/m1/s1 |
| InChIKey | FAMRSEXKWMWQPC-RUZDIDTESA-N |
| XLogP | 6.59 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|