C18H19N5S — CID 25142691
(11R,15S)-5-benzyl-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-triene-7-thione (PubChem CID 25142691) has the molecular formula C18H19N5S and a molecular weight of 337.45 g/mol. Its IUPAC name is (11R,15S)-5-benzyl-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-triene-7-thione.
| Compound Name | (11R,15S)-5-benzyl-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-triene-7-thione |
|---|---|
| PubChem CID | 25142691 |
| Molecular Formula | C18H19N5S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (11R,15S)-5-benzyl-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-triene-7-thione |
| SMILES | CN1C(=S)c2c(ncn2Cc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C18H19N5S/c1-21-17(24)15-16(23-14-9-5-8-13(14)20-18(21)23)19-11-22(15)10-12-6-3-2-4-7-12/h2-4,6-7,11,13-14H,5,8-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | RAUBPYMDHUGSNO-KGLIPLIRSA-N |
| XLogP | 2.65 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|