C22H33NO3 — CID 25150173
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(2-methoxyanilino)pent-4-enoate (PubChem CID 25150173) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(2-methoxyanilino)pent-4-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(2-methoxyanilino)pent-4-enoate |
|---|---|
| PubChem CID | 25150173 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(2-methoxyanilino)pent-4-enoate |
| SMILES | C=CC[C@H](Nc1ccccc1OC)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C22H33NO3/c1-6-9-19(23-18-10-7-8-11-20(18)25-5)22(24)26-21-14-16(4)12-13-17(21)15(2)3/h6-8,10-11,15-17,19,21,23H,1,9,12-14H2,2-5H3/t16-,17+,19+,21-/m1/s1 |
| InChIKey | HOQGIIPVZOZLBP-QRKMNUTDSA-N |
| XLogP | 5.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|