C20H31N3O3 — CID 25171083
tert-butyl 5-amino-3-[2-(diethylamino)ethoxy]-2-methylindole-1-carboxylate (PubChem CID 25171083) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is tert-butyl 5-amino-3-[2-(diethylamino)ethoxy]-2-methylindole-1-carboxylate.
| Compound Name | tert-butyl 5-amino-3-[2-(diethylamino)ethoxy]-2-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 25171083 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | tert-butyl 5-amino-3-[2-(diethylamino)ethoxy]-2-methylindole-1-carboxylate |
| SMILES | CCN(CC)CCOc1c(C)n(C(=O)OC(C)(C)C)c2ccc(N)cc12 |
| InChI | InChI=1S/C20H31N3O3/c1-7-22(8-2)11-12-25-18-14(3)23(19(24)26-20(4,5)6)17-10-9-15(21)13-16(17)18/h9-10,13H,7-8,11-12,21H2,1-6H3 |
| InChIKey | IBNZXUPDFYPEJQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|