C29H39NO4 — CID 25174122
(4S)-4-benzyl-3-[(3R)-3-ethyl-3-[(S)-hydroxy-(4-methoxyphenyl)methyl]non-1-en-2-yl]-1,3-oxazolidin-2-one (PubChem CID 25174122) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(3R)-3-ethyl-3-[(S)-hydroxy-(4-methoxyphenyl)methyl]non-1-en-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(3R)-3-ethyl-3-[(S)-hydroxy-(4-methoxyphenyl)methyl]non-1-en-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 25174122 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | (4S)-4-benzyl-3-[(3R)-3-ethyl-3-[(S)-hydroxy-(4-methoxyphenyl)methyl]non-1-en-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C=C(N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@](CC)(CCCCCC)[C@@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H39NO4/c1-5-7-8-12-19-29(6-2,27(31)24-15-17-26(33-4)18-16-24)22(3)30-25(21-34-28(30)32)20-23-13-10-9-11-14-23/h9-11,13-18,25,27,31H,3,5-8,12,19-21H2,1-2,4H3/t25-,27-,29+/m0/s1 |
| InChIKey | UPHIJZBOZZVLAN-MDZVADFISA-N |
| XLogP | 6.67 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|