C31H43NO4 — CID 25174125
(4S)-4-benzyl-3-[(3R)-3-butyl-3-[(S)-hydroxy-(4-methoxyphenyl)methyl]non-1-en-2-yl]-1,3-oxazolidin-2-one (PubChem CID 25174125) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(3R)-3-butyl-3-[(S)-hydroxy-(4-methoxyphenyl)methyl]non-1-en-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(3R)-3-butyl-3-[(S)-hydroxy-(4-methoxyphenyl)methyl]non-1-en-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 25174125 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | (4S)-4-benzyl-3-[(3R)-3-butyl-3-[(S)-hydroxy-(4-methoxyphenyl)methyl]non-1-en-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C=C(N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@](CCCC)(CCCCCC)[C@@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H43NO4/c1-5-7-9-13-21-31(20-8-6-2,29(33)26-16-18-28(35-4)19-17-26)24(3)32-27(23-36-30(32)34)22-25-14-11-10-12-15-25/h10-12,14-19,27,29,33H,3,5-9,13,20-23H2,1-2,4H3/t27-,29-,31+/m0/s1 |
| InChIKey | SBOMBXAUGNFXQL-DEDOGFMKSA-N |
| XLogP | 7.45 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|