C25H20ClF4N3O2 — CID 25184279
6-chloro-4-cyclopropyl-4-(4-fluorophenyl)-1-[(1-oxidopyridin-1-ium-4-yl)methyl]-3-(2,2,2-trifluoroethyl)quinazolin-2-one (PubChem CID 25184279) has the molecular formula C25H20ClF4N3O2 and a molecular weight of 505.90 g/mol. Its IUPAC name is 6-chloro-4-cyclopropyl-4-(4-fluorophenyl)-1-[(1-oxidopyridin-1-ium-4-yl)methyl]-3-(2,2,2-trifluoroethyl)quinazolin-2-one.
| Compound Name | 6-chloro-4-cyclopropyl-4-(4-fluorophenyl)-1-[(1-oxidopyridin-1-ium-4-yl)methyl]-3-(2,2,2-trifluoroethyl)quinazolin-2-one |
|---|---|
| PubChem CID | 25184279 |
| Molecular Formula | C25H20ClF4N3O2 |
| Molecular Weight | 505.90 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 6-chloro-4-cyclopropyl-4-(4-fluorophenyl)-1-[(1-oxidopyridin-1-ium-4-yl)methyl]-3-(2,2,2-trifluoroethyl)quinazolin-2-one |
| SMILES | O=C1N(Cc2cc[n+]([O-])cc2)c2ccc(Cl)cc2C(c2ccc(F)cc2)(C2CC2)N1CC(F)(F)F |
| InChI | InChI=1S/C25H20ClF4N3O2/c26-19-5-8-22-21(13-19)25(17-1-2-17,18-3-6-20(27)7-4-18)33(15-24(28,29)30)23(34)32(22)14-16-9-11-31(35)12-10-16/h3-13,17H,1-2,14-15H2 |
| InChIKey | SMYPTBOGOOWNTQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.90 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|