C16H14O2 — CID 25187487
(1-methyl-1,3-dihydro-2-benzofuran-5-yl)-phenylmethanone (PubChem CID 25187487) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is (1-methyl-1,3-dihydro-2-benzofuran-5-yl)-phenylmethanone.
| Compound Name | (1-methyl-1,3-dihydro-2-benzofuran-5-yl)-phenylmethanone |
|---|---|
| PubChem CID | 25187487 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1-methyl-1,3-dihydro-2-benzofuran-5-yl)-phenylmethanone |
| SMILES | CC1OCc2cc(C(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C16H14O2/c1-11-15-8-7-13(9-14(15)10-18-11)16(17)12-5-3-2-4-6-12/h2-9,11H,10H2,1H3 |
| InChIKey | BFQDFQDEAJBRPU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |