C14H14N4S — CID 25190901
9-methyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaen-15-amine (PubChem CID 25190901) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 9-methyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaen-15-amine.
| Compound Name | 9-methyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaen-15-amine |
|---|---|
| PubChem CID | 25190901 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 9-methyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaen-15-amine |
| SMILES | Cc1c2c(nc3sc4c(N)ncnc4c13)CCCC2 |
| InChI | InChI=1S/C14H14N4S/c1-7-8-4-2-3-5-9(8)18-14-10(7)11-12(19-14)13(15)17-6-16-11/h6H,2-5H2,1H3,(H2,15,16,17) |
| InChIKey | GUDXENVGLUFJOJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |