C24H18O4 — CID 25194923
(3-oxo-2,4,5-triphenylfuran-2-yl) acetate (PubChem CID 25194923) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is (3-oxo-2,4,5-triphenylfuran-2-yl) acetate.
| Compound Name | (3-oxo-2,4,5-triphenylfuran-2-yl) acetate |
|---|---|
| PubChem CID | 25194923 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (3-oxo-2,4,5-triphenylfuran-2-yl) acetate |
| SMILES | CC(=O)OC1(c2ccccc2)OC(c2ccccc2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H18O4/c1-17(25)27-24(20-15-9-4-10-16-20)23(26)21(18-11-5-2-6-12-18)22(28-24)19-13-7-3-8-14-19/h2-16H,1H3 |
| InChIKey | MQLYWSUEVABDMZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|