C32H39NO6 — CID 25198238
methyl 3-[3-methoxy-4-[4-[4-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]phenoxy]butoxy]phenyl]propanoate (PubChem CID 25198238) has the molecular formula C32H39NO6 and a molecular weight of 533.67 g/mol. Its IUPAC name is methyl 3-[3-methoxy-4-[4-[4-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]phenoxy]butoxy]phenyl]propanoate.
| Compound Name | methyl 3-[3-methoxy-4-[4-[4-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]phenoxy]butoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 25198238 |
| Molecular Formula | C32H39NO6 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | methyl 3-[3-methoxy-4-[4-[4-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]phenoxy]butoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCCCCOc2ccc(CC(=O)N(C)CCc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C32H39NO6/c1-33(20-19-25-9-5-4-6-10-25)31(34)24-27-11-15-28(16-12-27)38-21-7-8-22-39-29-17-13-26(23-30(29)36-2)14-18-32(35)37-3/h4-6,9-13,15-17,23H,7-8,14,18-22,24H2,1-3H3 |
| InChIKey | WQHHLBAVBNLKNM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|