C11H13N3O2 — CID 25220818
6-(propylamino)-2,3-dihydrophthalazine-1,4-dione (PubChem CID 25220818) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 6-(propylamino)-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 6-(propylamino)-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 25220818 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 6-(propylamino)-2,3-dihydrophthalazine-1,4-dione |
| SMILES | CCCNc1ccc2c(=O)[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C11H13N3O2/c1-2-5-12-7-3-4-8-9(6-7)11(16)14-13-10(8)15/h3-4,6,12H,2,5H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | PGQOPOZRKLAWGY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |