C32H31N3O3S — CID 25221638
2-[5-[1-(5-aminopentyl)-2-phenylindole-6-carbonyl]-2-phenylthiophen-3-yl]-N-hydroxyacetamide (PubChem CID 25221638) has the molecular formula C32H31N3O3S and a molecular weight of 537.69 g/mol. Its IUPAC name is 2-[5-[1-(5-aminopentyl)-2-phenylindole-6-carbonyl]-2-phenylthiophen-3-yl]-N-hydroxyacetamide.
| Compound Name | 2-[5-[1-(5-aminopentyl)-2-phenylindole-6-carbonyl]-2-phenylthiophen-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 25221638 |
| Molecular Formula | C32H31N3O3S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-[5-[1-(5-aminopentyl)-2-phenylindole-6-carbonyl]-2-phenylthiophen-3-yl]-N-hydroxyacetamide |
| SMILES | NCCCCCn1c(-c2ccccc2)cc2ccc(C(=O)c3cc(CC(=O)NO)c(-c4ccccc4)s3)cc21 |
| InChI | InChI=1S/C32H31N3O3S/c33-16-8-3-9-17-35-27(22-10-4-1-5-11-22)18-24-14-15-25(19-28(24)35)31(37)29-20-26(21-30(36)34-38)32(39-29)23-12-6-2-7-13-23/h1-2,4-7,10-15,18-20,38H,3,8-9,16-17,21,33H2,(H,34,36) |
| InChIKey | XLOVBSNNECCILX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|