C34H34N2O3S — CID 173158297
tert-butyl N-[4-[2-phenyl-6-(5-phenylthiophene-2-carbonyl)indol-1-yl]butyl]carbamate (PubChem CID 173158297) has the molecular formula C34H34N2O3S and a molecular weight of 550.72 g/mol. Its IUPAC name is tert-butyl N-[4-[2-phenyl-6-(5-phenylthiophene-2-carbonyl)indol-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-phenyl-6-(5-phenylthiophene-2-carbonyl)indol-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 173158297 |
| Molecular Formula | C34H34N2O3S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | tert-butyl N-[4-[2-phenyl-6-(5-phenylthiophene-2-carbonyl)indol-1-yl]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCn1c(-c2ccccc2)cc2ccc(C(=O)c3ccc(-c4ccccc4)s3)cc21 |
| InChI | InChI=1S/C34H34N2O3S/c1-34(2,3)39-33(38)35-20-10-11-21-36-28(24-12-6-4-7-13-24)22-26-16-17-27(23-29(26)36)32(37)31-19-18-30(40-31)25-14-8-5-9-15-25/h4-9,12-19,22-23H,10-11,20-21H2,1-3H3,(H,35,38) |
| InChIKey | XQSDUHTUFGPFFS-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|