C32H32N2O4 — CID 5461697
tert-butyl 1-[2-[(3-benzoylbenzoyl)amino]ethyl]-2-methyl-5-phenylpyrrole-3-carboxylate (PubChem CID 5461697) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is tert-butyl 1-[2-[(3-benzoylbenzoyl)amino]ethyl]-2-methyl-5-phenylpyrrole-3-carboxylate.
| Compound Name | tert-butyl 1-[2-[(3-benzoylbenzoyl)amino]ethyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 5461697 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | tert-butyl 1-[2-[(3-benzoylbenzoyl)amino]ethyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)(C)C)cc(-c2ccccc2)n1CCNC(=O)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C32H32N2O4/c1-22-27(31(37)38-32(2,3)4)21-28(23-12-7-5-8-13-23)34(22)19-18-33-30(36)26-17-11-16-25(20-26)29(35)24-14-9-6-10-15-24/h5-17,20-21H,18-19H2,1-4H3,(H,33,36) |
| InChIKey | UFSLIMAGDYPLPT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |