C31H29FN4O3S — CID 57335141
2-[5-[1-(4-aminobutyl)-3-fluoro-2-phenylindole-6-carbonyl]-2-(3-aminophenyl)thiophen-3-yl]-N-hydroxyacetamide (PubChem CID 57335141) has the molecular formula C31H29FN4O3S and a molecular weight of 556.66 g/mol. Its IUPAC name is 2-[5-[1-(4-aminobutyl)-3-fluoro-2-phenylindole-6-carbonyl]-2-(3-aminophenyl)thiophen-3-yl]-N-hydroxyacetamide.
| Compound Name | 2-[5-[1-(4-aminobutyl)-3-fluoro-2-phenylindole-6-carbonyl]-2-(3-aminophenyl)thiophen-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 57335141 |
| Molecular Formula | C31H29FN4O3S |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-[5-[1-(4-aminobutyl)-3-fluoro-2-phenylindole-6-carbonyl]-2-(3-aminophenyl)thiophen-3-yl]-N-hydroxyacetamide |
| SMILES | NCCCCn1c(-c2ccccc2)c(F)c2ccc(C(=O)c3cc(CC(=O)NO)c(-c4cccc(N)c4)s3)cc21 |
| InChI | InChI=1S/C31H29FN4O3S/c32-28-24-12-11-20(16-25(24)36(14-5-4-13-33)29(28)19-7-2-1-3-8-19)30(38)26-17-22(18-27(37)35-39)31(40-26)21-9-6-10-23(34)15-21/h1-3,6-12,15-17,39H,4-5,13-14,18,33-34H2,(H,35,37) |
| InChIKey | KGQHJOSXTDVLNM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|