C49H40N2O8S — CID 67497144
benzyl 4-[1-[4-(1,3-dioxoisoindol-2-yl)butyl]-6-[4-(2-ethoxy-2-oxoethyl)-5-(3-hydroxyphenyl)thiophene-2-carbonyl]indol-2-yl]benzoate (PubChem CID 67497144) has the molecular formula C49H40N2O8S and a molecular weight of 816.93 g/mol. Its IUPAC name is benzyl 4-[1-[4-(1,3-dioxoisoindol-2-yl)butyl]-6-[4-(2-ethoxy-2-oxoethyl)-5-(3-hydroxyphenyl)thiophene-2-carbonyl]indol-2-yl]benzoate.
| Compound Name | benzyl 4-[1-[4-(1,3-dioxoisoindol-2-yl)butyl]-6-[4-(2-ethoxy-2-oxoethyl)-5-(3-hydroxyphenyl)thiophene-2-carbonyl]indol-2-yl]benzoate |
|---|---|
| PubChem CID | 67497144 |
| Molecular Formula | C49H40N2O8S |
| Molecular Weight | 816.93 g/mol |
| Exact Mass | 816.25 |
| IUPAC Name | benzyl 4-[1-[4-(1,3-dioxoisoindol-2-yl)butyl]-6-[4-(2-ethoxy-2-oxoethyl)-5-(3-hydroxyphenyl)thiophene-2-carbonyl]indol-2-yl]benzoate |
| SMILES | CCOC(=O)Cc1cc(C(=O)c2ccc3cc(-c4ccc(C(=O)OCc5ccccc5)cc4)n(CCCCN4C(=O)c5ccccc5C4=O)c3c2)sc1-c1cccc(O)c1 |
| InChI | InChI=1S/C49H40N2O8S/c1-2-58-44(53)29-37-28-43(60-46(37)36-13-10-14-38(52)25-36)45(54)35-22-21-34-26-41(32-17-19-33(20-18-32)49(57)59-30-31-11-4-3-5-12-31)50(42(34)27-35)23-8-9-24-51-47(55)39-15-6-7-16-40(39)48(51)56/h3-7,10-22,25-28,52H,2,8-9,23-24,29-30H2,1H3 |
| InChIKey | ZOWKTJGXZNOMAG-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.93 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|