C16H16O5 — CID 25232869
[(2S,3R,4S,5R)-4-but-2-ynoyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-2-ynoate (PubChem CID 25232869) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-4-but-2-ynoyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-2-ynoate.
| Compound Name | [(2S,3R,4S,5R)-4-but-2-ynoyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-2-ynoate |
|---|---|
| PubChem CID | 25232869 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [(2S,3R,4S,5R)-4-but-2-ynoyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-2-ynoate |
| SMILES | C=C[C@@H]1O[C@H](C=C)[C@H](OC(=O)C#CC)[C@@H]1OC(=O)C#CC |
| InChI | InChI=1S/C16H16O5/c1-5-9-13(17)20-15-11(7-3)19-12(8-4)16(15)21-14(18)10-6-2/h7-8,11-12,15-16H,3-4H2,1-2H3/t11-,12+,15+,16- |
| InChIKey | CDRPEWYAIIYRAO-CRJCFHLZSA-N |
| XLogP | 1.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|