About 2-(pentafluoro-λ6-sulfanyl)pentanoic acid
2-(pentafluoro-λ6-sulfanyl)pentanoic acid (PubChem CID 25263549) has the molecular formula C5H9F5O2S
and a molecular weight of 228.18 g/mol. Its IUPAC name is 2-(pentafluoro-λ6-sulfanyl)pentanoic acid.
Molecular Properties
| Compound Name | 2-(pentafluoro-λ6-sulfanyl)pentanoic acid |
| PubChem CID | 25263549 |
| Molecular Formula | C5H9F5O2S |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 2-(pentafluoro-λ6-sulfanyl)pentanoic acid |
| SMILES | CCCC(C(=O)O)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C5H9F5O2S/c1-2-3-4(5(11)12)13(6,7,8,9)10/h4H,2-3H2,1H3,(H,11,12) |
| InChIKey | ROLRUEFOHMEPPL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(pentafluoro-λ6-sulfanyl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pentafluoro-λ6-sulfanyl)pentanoic acid?
The IUPAC name of 2-(pentafluoro-λ6-sulfanyl)pentanoic acid (CID 25263549) is 2-(pentafluoro-λ6-sulfanyl)pentanoic acid.
What is the SMILES notation for 2-(pentafluoro-λ6-sulfanyl)pentanoic acid?
The canonical SMILES for 2-(pentafluoro-λ6-sulfanyl)pentanoic acid is CCCC(C(=O)O)S(F)(F)(F)(F)F.
What is the InChIKey of 2-(pentafluoro-λ6-sulfanyl)pentanoic acid?
The InChIKey is ROLRUEFOHMEPPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F5O2S/c1-2-3-4(5(11)12)13(6,7,8,9)10/h4H,2-3H2,1H3,(H,11,12).
What are the key properties of 2-(pentafluoro-λ6-sulfanyl)pentanoic acid?
2-(pentafluoro-λ6-sulfanyl)pentanoic acid has a molecular weight of 228.18 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pentafluoro-λ6-sulfanyl)pentanoic acid is sourced from PubChem (CID 25263549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).