C18H23N2O2+ — CID 25273190
[(2S)-3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]-(furan-2-ylmethyl)azanium (PubChem CID 25273190) has the molecular formula C18H23N2O2+ and a molecular weight of 299.39 g/mol. Its IUPAC name is [(2S)-3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]-(furan-2-ylmethyl)azanium.
| Compound Name | [(2S)-3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 25273190 |
| Molecular Formula | C18H23N2O2+ |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | [(2S)-3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]-(furan-2-ylmethyl)azanium |
| SMILES | Cc1c(C)n(C[C@@H](O)C[NH2+]Cc2ccco2)c2ccccc12 |
| InChI | InChI=1S/C18H22N2O2/c1-13-14(2)20(18-8-4-3-7-17(13)18)12-15(21)10-19-11-16-6-5-9-22-16/h3-9,15,19,21H,10-12H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | ATYFJNBTKOAQSM-HNNXBMFYSA-O |
| XLogP | 1.98 |
| TPSA | 54.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|