C21H22N4O4S — CID 25372891
1-ethyl-N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-2,3-dioxo-4H-quinoxaline-6-carbohydrazide (PubChem CID 25372891) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-ethyl-N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-2,3-dioxo-4H-quinoxaline-6-carbohydrazide.
| Compound Name | 1-ethyl-N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-2,3-dioxo-4H-quinoxaline-6-carbohydrazide |
|---|---|
| PubChem CID | 25372891 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-ethyl-N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-2,3-dioxo-4H-quinoxaline-6-carbohydrazide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NNC(=O)c3cc4c(s3)CC[C@H](C)C4)ccc21 |
| InChI | InChI=1S/C21H22N4O4S/c1-3-25-15-6-5-12(9-14(15)22-20(28)21(25)29)18(26)23-24-19(27)17-10-13-8-11(2)4-7-16(13)30-17/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,22,28)(H,23,26)(H,24,27)/t11-/m0/s1 |
| InChIKey | KCFOXBWGSUMDLA-NSHDSACASA-N |
| XLogP | 1.97 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|