C25H28N6O3 — CID 25373374
N'-[2-(2-ethylbenzimidazol-1-yl)acetyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 25373374) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is N'-[2-(2-ethylbenzimidazol-1-yl)acetyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-[2-(2-ethylbenzimidazol-1-yl)acetyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 25373374 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N'-[2-(2-ethylbenzimidazol-1-yl)acetyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)Cn2c(CC)nc3ccccc32)c2ccccc2c1=O |
| InChI | InChI=1S/C25H28N6O3/c1-3-5-10-15-31-25(34)18-12-7-6-11-17(18)23(29-31)24(33)28-27-22(32)16-30-20-14-9-8-13-19(20)26-21(30)4-2/h6-9,11-14H,3-5,10,15-16H2,1-2H3,(H,27,32)(H,28,33) |
| InChIKey | YRRBJJHQYJURBU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|