C15H26N2O3 — CID 25456655
1-[(2R)-2-(4-methylpentyl)morpholine-4-carbonyl]cyclopropane-1-carboxamide (PubChem CID 25456655) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[(2R)-2-(4-methylpentyl)morpholine-4-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[(2R)-2-(4-methylpentyl)morpholine-4-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 25456655 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-[(2R)-2-(4-methylpentyl)morpholine-4-carbonyl]cyclopropane-1-carboxamide |
| SMILES | CC(C)CCC[C@@H]1CN(C(=O)C2(C(N)=O)CC2)CCO1 |
| InChI | InChI=1S/C15H26N2O3/c1-11(2)4-3-5-12-10-17(8-9-20-12)14(19)15(6-7-15)13(16)18/h11-12H,3-10H2,1-2H3,(H2,16,18)/t12-/m1/s1 |
| InChIKey | IVXHTUNNFSRSNO-GFCCVEGCSA-N |
| XLogP | 1.31 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|