C24H30N6O3S — CID 26140398
N-[3-(dimethylamino)phenyl]-3-[(1-methylpyrazol-4-yl)methylamino]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 26140398) has the molecular formula C24H30N6O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-[3-(dimethylamino)phenyl]-3-[(1-methylpyrazol-4-yl)methylamino]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-(dimethylamino)phenyl]-3-[(1-methylpyrazol-4-yl)methylamino]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26140398 |
| Molecular Formula | C24H30N6O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | N-[3-(dimethylamino)phenyl]-3-[(1-methylpyrazol-4-yl)methylamino]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CN(C)c1cccc(NC(=O)c2cc(NCc3cnn(C)c3)cc(S(=O)(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C24H30N6O3S/c1-28(2)22-8-6-7-20(13-22)27-24(31)19-11-21(25-15-18-16-26-29(3)17-18)14-23(12-19)34(32,33)30-9-4-5-10-30/h6-8,11-14,16-17,25H,4-5,9-10,15H2,1-3H3,(H,27,31) |
| InChIKey | XAKKRGAXWUXDMN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|