C21H15NO6 — CID 2631168
(5-methoxycarbonylfuran-2-yl)methyl 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 2631168) has the molecular formula C21H15NO6 and a molecular weight of 377.35 g/mol. Its IUPAC name is (5-methoxycarbonylfuran-2-yl)methyl 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | (5-methoxycarbonylfuran-2-yl)methyl 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2631168 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (5-methoxycarbonylfuran-2-yl)methyl 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)c2cc(-c3ccco3)nc3ccccc23)o1 |
| InChI | InChI=1S/C21H15NO6/c1-25-21(24)19-9-8-13(28-19)12-27-20(23)15-11-17(18-7-4-10-26-18)22-16-6-3-2-5-14(15)16/h2-11H,12H2,1H3 |
| InChIKey | WEKOVNCTYADQQJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |