C25H34N6O2S — CID 26342606
N-[(1S)-2-methyl-1-[7-[[4-(N-methylanilino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]propyl]methanesulfonamide (PubChem CID 26342606) has the molecular formula C25H34N6O2S and a molecular weight of 482.65 g/mol. Its IUPAC name is N-[(1S)-2-methyl-1-[7-[[4-(N-methylanilino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]propyl]methanesulfonamide.
| Compound Name | N-[(1S)-2-methyl-1-[7-[[4-(N-methylanilino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 26342606 |
| Molecular Formula | C25H34N6O2S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | N-[(1S)-2-methyl-1-[7-[[4-(N-methylanilino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]propyl]methanesulfonamide |
| SMILES | CC(C)[C@H](NS(C)(=O)=O)c1nnc2n1CCN(Cc1ccc(N(C)c3ccccc3)cc1)CC2 |
| InChI | InChI=1S/C25H34N6O2S/c1-19(2)24(28-34(4,32)33)25-27-26-23-14-15-30(16-17-31(23)25)18-20-10-12-22(13-11-20)29(3)21-8-6-5-7-9-21/h5-13,19,24,28H,14-18H2,1-4H3/t24-/m0/s1 |
| InChIKey | GIOZVHNLCUMFLH-DEOSSOPVSA-N |
| XLogP | 3.35 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |