C18H27N5O3S — CID 45194271
N-[1-[7-[(2-hydroxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide (PubChem CID 45194271) has the molecular formula C18H27N5O3S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[1-[7-[(2-hydroxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide.
| Compound Name | N-[1-[7-[(2-hydroxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 45194271 |
| Molecular Formula | C18H27N5O3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[1-[7-[(2-hydroxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
| SMILES | CC(C)C(NS(C)(=O)=O)c1nnc2n1CCN(Cc1ccccc1O)CC2 |
| InChI | InChI=1S/C18H27N5O3S/c1-13(2)17(21-27(3,25)26)18-20-19-16-8-9-22(10-11-23(16)18)12-14-6-4-5-7-15(14)24/h4-7,13,17,21,24H,8-12H2,1-3H3 |
| InChIKey | HAPZIOYHZYVAAU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|