C20H31N5O4S — CID 45231069
N-[1-[7-[(3,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide (PubChem CID 45231069) has the molecular formula C20H31N5O4S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[1-[7-[(3,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide.
| Compound Name | N-[1-[7-[(3,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 45231069 |
| Molecular Formula | C20H31N5O4S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[1-[7-[(3,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
| SMILES | COc1cc(CN2CCc3nnc(C(NS(C)(=O)=O)C(C)C)n3CC2)cc(OC)c1 |
| InChI | InChI=1S/C20H31N5O4S/c1-14(2)19(23-30(5,26)27)20-22-21-18-6-7-24(8-9-25(18)20)13-15-10-16(28-3)12-17(11-15)29-4/h10-12,14,19,23H,6-9,13H2,1-5H3 |
| InChIKey | VKKRYYGUQHXWEQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |