C20H32N6O2S — CID 126465436
N-[1-[7-[[4-(dimethylamino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide (PubChem CID 126465436) has the molecular formula C20H32N6O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-[1-[7-[[4-(dimethylamino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide.
| Compound Name | N-[1-[7-[[4-(dimethylamino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 126465436 |
| Molecular Formula | C20H32N6O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[1-[7-[[4-(dimethylamino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
| SMILES | CC(C)C(NS(C)(=O)=O)c1nnc2n1CCN(Cc1ccc(N(C)C)cc1)CC2 |
| InChI | InChI=1S/C20H32N6O2S/c1-15(2)19(23-29(5,27)28)20-22-21-18-10-11-25(12-13-26(18)20)14-16-6-8-17(9-7-16)24(3)4/h6-9,15,19,23H,10-14H2,1-5H3 |
| InChIKey | SRCAATJELZFUIG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|