C21H33N5O5S — CID 42481624
N-[(1R)-2-methyl-1-[7-[(2,3,4-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]propyl]methanesulfonamide (PubChem CID 42481624) has the molecular formula C21H33N5O5S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-[(1R)-2-methyl-1-[7-[(2,3,4-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]propyl]methanesulfonamide.
| Compound Name | N-[(1R)-2-methyl-1-[7-[(2,3,4-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 42481624 |
| Molecular Formula | C21H33N5O5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[(1R)-2-methyl-1-[7-[(2,3,4-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]propyl]methanesulfonamide |
| SMILES | COc1ccc(CN2CCc3nnc([C@H](NS(C)(=O)=O)C(C)C)n3CC2)c(OC)c1OC |
| InChI | InChI=1S/C21H33N5O5S/c1-14(2)18(24-32(6,27)28)21-23-22-17-9-10-25(11-12-26(17)21)13-15-7-8-16(29-3)20(31-5)19(15)30-4/h7-8,14,18,24H,9-13H2,1-6H3/t18-/m1/s1 |
| InChIKey | AGEBXNPTHWWASA-GOSISDBHSA-N |
| XLogP | 1.61 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |