C19H28FN5O3S — CID 45212831
N-[1-[7-[(2-fluoro-5-methoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide (PubChem CID 45212831) has the molecular formula C19H28FN5O3S and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[1-[7-[(2-fluoro-5-methoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide.
| Compound Name | N-[1-[7-[(2-fluoro-5-methoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 45212831 |
| Molecular Formula | C19H28FN5O3S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-[1-[7-[(2-fluoro-5-methoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
| SMILES | COc1ccc(F)c(CN2CCc3nnc(C(NS(C)(=O)=O)C(C)C)n3CC2)c1 |
| InChI | InChI=1S/C19H28FN5O3S/c1-13(2)18(23-29(4,26)27)19-22-21-17-7-8-24(9-10-25(17)19)12-14-11-15(28-3)5-6-16(14)20/h5-6,11,13,18,23H,7-10,12H2,1-4H3 |
| InChIKey | BACFPSIJHDFYFN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |