C19H29N5O4S — CID 42451721
N-[(1R)-1-[7-[(2-hydroxy-5-methoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide (PubChem CID 42451721) has the molecular formula C19H29N5O4S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[(1R)-1-[7-[(2-hydroxy-5-methoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide.
| Compound Name | N-[(1R)-1-[7-[(2-hydroxy-5-methoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 42451721 |
| Molecular Formula | C19H29N5O4S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[(1R)-1-[7-[(2-hydroxy-5-methoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-2-methylpropyl]methanesulfonamide |
| SMILES | COc1ccc(O)c(CN2CCc3nnc([C@H](NS(C)(=O)=O)C(C)C)n3CC2)c1 |
| InChI | InChI=1S/C19H29N5O4S/c1-13(2)18(22-29(4,26)27)19-21-20-17-7-8-23(9-10-24(17)19)12-14-11-15(28-3)5-6-16(14)25/h5-6,11,13,18,22,25H,7-10,12H2,1-4H3/t18-/m1/s1 |
| InChIKey | YANZOOFLZTZIAJ-GOSISDBHSA-N |
| XLogP | 1.30 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|