C30H37N5O2 — CID 26624494
N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[[2-(2,3-dimethylanilino)-2-oxoethyl]-methylamino]acetamide (PubChem CID 26624494) has the molecular formula C30H37N5O2 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[[2-(2,3-dimethylanilino)-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[[2-(2,3-dimethylanilino)-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 26624494 |
| Molecular Formula | C30H37N5O2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-2-[[2-(2,3-dimethylanilino)-2-oxoethyl]-methylamino]acetamide |
| SMILES | Cc1cccc(NC(=O)CN(C)CC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)c1C |
| InChI | InChI=1S/C30H37N5O2/c1-23-8-7-11-28(24(23)2)32-30(37)22-33(3)21-29(36)31-26-12-14-27(15-13-26)35-18-16-34(17-19-35)20-25-9-5-4-6-10-25/h4-15H,16-22H2,1-3H3,(H,31,36)(H,32,37) |
| InChIKey | CMSDHXNKIHAGPL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|