C11H13BrF3NO3S — CID 26985676
2-bromo-N-butyl-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 26985676) has the molecular formula C11H13BrF3NO3S and a molecular weight of 376.19 g/mol. Its IUPAC name is 2-bromo-N-butyl-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 2-bromo-N-butyl-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 26985676 |
| Molecular Formula | C11H13BrF3NO3S |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 2-bromo-N-butyl-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(OC(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H13BrF3NO3S/c1-2-3-6-16-20(17,18)10-5-4-8(7-9(10)12)19-11(13,14)15/h4-5,7,16H,2-3,6H2,1H3 |
| InChIKey | RJZRYTZXGFVGDS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|