C20H19OS2+ — CID 27101180
2-methyl-4,6-bis(4-methylsulfanylphenyl)pyrylium (PubChem CID 27101180) has the molecular formula C20H19OS2+ and a molecular weight of 339.51 g/mol. Its IUPAC name is 2-methyl-4,6-bis(4-methylsulfanylphenyl)pyrylium.
| Compound Name | 2-methyl-4,6-bis(4-methylsulfanylphenyl)pyrylium |
|---|---|
| PubChem CID | 27101180 |
| Molecular Formula | C20H19OS2+ |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-methyl-4,6-bis(4-methylsulfanylphenyl)pyrylium |
| SMILES | CSc1ccc(-c2cc(C)[o+]c(-c3ccc(SC)cc3)c2)cc1 |
| InChI | InChI=1S/C20H19OS2/c1-14-12-17(15-4-8-18(22-2)9-5-15)13-20(21-14)16-6-10-19(23-3)11-7-16/h4-13H,1-3H3/q+1 |
| InChIKey | UTLBZERAZVTUQI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|